C21H21ClN2O3S — CID 58258797
5-(3-chlorophenyl)sulfonyl-7-methoxy-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 58258797) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is 5-(3-chlorophenyl)sulfonyl-7-methoxy-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-(3-chlorophenyl)sulfonyl-7-methoxy-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 58258797 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5-(3-chlorophenyl)sulfonyl-7-methoxy-9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | COc1cc(S(=O)(=O)c2cccc(Cl)c2)cc2c3c(n(C)c12)CC1CCC3N1 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-24-18-9-13-6-7-17(23-13)20(18)16-10-15(11-19(27-2)21(16)24)28(25,26)14-5-3-4-12(22)8-14/h3-5,8,10-11,13,17,23H,6-7,9H2,1-2H3 |
| InChIKey | IFPKQBGRFPZAFI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|