C22H23ClN2O3S — CID 58258817
5-(3-chlorophenyl)sulfonyl-7-methoxy-9,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 58258817) has the molecular formula C22H23ClN2O3S and a molecular weight of 430.96 g/mol. Its IUPAC name is 5-(3-chlorophenyl)sulfonyl-7-methoxy-9,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-(3-chlorophenyl)sulfonyl-7-methoxy-9,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 58258817 |
| Molecular Formula | C22H23ClN2O3S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 5-(3-chlorophenyl)sulfonyl-7-methoxy-9,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | COc1cc(S(=O)(=O)c2cccc(Cl)c2)cc2c3c(n(C)c12)CC1CCC3N1C |
| InChI | InChI=1S/C22H23ClN2O3S/c1-24-14-7-8-18(24)21-17-11-16(29(26,27)15-6-4-5-13(23)9-15)12-20(28-3)22(17)25(2)19(21)10-14/h4-6,9,11-12,14,18H,7-8,10H2,1-3H3 |
| InChIKey | UVRQUFZUTAJRPH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|