C22H21FN4O3S — CID 58259041
3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-methylsulfonyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58259041) has the molecular formula C22H21FN4O3S and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-methylsulfonyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-methylsulfonyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58259041 |
| Molecular Formula | C22H21FN4O3S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 3-[[2-fluoro-6-[2-(6-methoxy-3-pyridinyl)ethyl]-3-pyridinyl]methyl]-5-methylsulfonyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(CCc2ccc(Cc3c[nH]c4ncc(S(C)(=O)=O)cc34)c(F)n2)cn1 |
| InChI | InChI=1S/C22H21FN4O3S/c1-30-20-8-4-14(11-24-20)3-6-17-7-5-15(21(23)27-17)9-16-12-25-22-19(16)10-18(13-26-22)31(2,28)29/h4-5,7-8,10-13H,3,6,9H2,1-2H3,(H,25,26) |
| InChIKey | JGALOZJEZXAVGT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|