C22H19ClFN3O — CID 58259249
3-[[6-[2-(2-chlorophenyl)ethyl]-2-fluoro-3-pyridinyl]methyl]-5-methoxy-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58259249) has the molecular formula C22H19ClFN3O and a molecular weight of 395.87 g/mol. Its IUPAC name is 3-[[6-[2-(2-chlorophenyl)ethyl]-2-fluoro-3-pyridinyl]methyl]-5-methoxy-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[[6-[2-(2-chlorophenyl)ethyl]-2-fluoro-3-pyridinyl]methyl]-5-methoxy-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58259249 |
| Molecular Formula | C22H19ClFN3O |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-[[6-[2-(2-chlorophenyl)ethyl]-2-fluoro-3-pyridinyl]methyl]-5-methoxy-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1cnc2[nH]cc(Cc3ccc(CCc4ccccc4Cl)nc3F)c2c1 |
| InChI | InChI=1S/C22H19ClFN3O/c1-28-18-11-19-16(12-25-22(19)26-13-18)10-15-7-9-17(27-21(15)24)8-6-14-4-2-3-5-20(14)23/h2-5,7,9,11-13H,6,8,10H2,1H3,(H,25,26) |
| InChIKey | MOZFVXAMHXNBLI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|