About 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine
5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine (PubChem CID 58259494) has the molecular formula C13H10BrFN4
and a molecular weight of 321.15 g/mol. Its IUPAC name is 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine |
| PubChem CID | 58259494 |
| Molecular Formula | C13H10BrFN4 |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine |
| SMILES | Nc1ccc(Cc2c[nH]c3ncc(Br)cc23)c(F)n1 |
| InChI | InChI=1S/C13H10BrFN4/c14-9-4-10-8(5-17-13(10)18-6-9)3-7-1-2-11(16)19-12(7)15/h1-2,4-6H,3H2,(H2,16,19)(H,17,18) |
| InChIKey | PBUPMRWNSYVMRS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine?
The IUPAC name of 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine (CID 58259494) is 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine.
What is the SMILES notation for 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine?
The canonical SMILES for 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine is Nc1ccc(Cc2c[nH]c3ncc(Br)cc23)c(F)n1.
What is the InChIKey of 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine?
The InChIKey is PBUPMRWNSYVMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrFN4/c14-9-4-10-8(5-17-13(10)18-6-9)3-7-1-2-11(16)19-12(7)15/h1-2,4-6H,3H2,(H2,16,19)(H,17,18).
What are the key properties of 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine?
5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine has a molecular weight of 321.15 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]-6-fluoropyridin-2-amine is sourced from PubChem (CID 58259494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).