C26H22F3N3O3S — CID 58259587
4-[3-[3-[2-ethyl-8-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]phenoxy]phenyl]sulfonylbutanenitrile (PubChem CID 58259587) has the molecular formula C26H22F3N3O3S and a molecular weight of 513.54 g/mol. Its IUPAC name is 4-[3-[3-[2-ethyl-8-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]phenoxy]phenyl]sulfonylbutanenitrile.
| Compound Name | 4-[3-[3-[2-ethyl-8-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]phenoxy]phenyl]sulfonylbutanenitrile |
|---|---|
| PubChem CID | 58259587 |
| Molecular Formula | C26H22F3N3O3S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 4-[3-[3-[2-ethyl-8-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]phenoxy]phenyl]sulfonylbutanenitrile |
| SMILES | CCc1nc2c(C(F)(F)F)cccn2c1-c1cccc(Oc2cccc(S(=O)(=O)CCCC#N)c2)c1 |
| InChI | InChI=1S/C26H22F3N3O3S/c1-2-23-24(32-14-7-12-22(25(32)31-23)26(27,28)29)18-8-5-9-19(16-18)35-20-10-6-11-21(17-20)36(33,34)15-4-3-13-30/h5-12,14,16-17H,2-4,15H2,1H3 |
| InChIKey | SIKDPMBPXLWIJM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|