C8H13N3O2S — CID 58259659
2,8,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[5,1-c][1,4]thiazine 7,7-dioxide (PubChem CID 58259659) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2,8,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[5,1-c][1,4]thiazine 7,7-dioxide.
| Compound Name | 2,8,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[5,1-c][1,4]thiazine 7,7-dioxide |
|---|---|
| PubChem CID | 58259659 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2,8,8-trimethyl-5,6-dihydro-[1,2,4]triazolo[5,1-c][1,4]thiazine 7,7-dioxide |
| SMILES | Cc1nc2n(n1)CCS(=O)(=O)C2(C)C |
| InChI | InChI=1S/C8H13N3O2S/c1-6-9-7-8(2,3)14(12,13)5-4-11(7)10-6/h4-5H2,1-3H3 |
| InChIKey | MJWLZRHARMLSSA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |