C6H11N3O — CID 58259870
3-(methoxymethyl)-4,5-dimethyl-1,2,4-triazole (PubChem CID 58259870) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-(methoxymethyl)-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-(methoxymethyl)-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 58259870 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 3-(methoxymethyl)-4,5-dimethyl-1,2,4-triazole |
| SMILES | COCc1nnc(C)n1C |
| InChI | InChI=1S/C6H11N3O/c1-5-7-8-6(4-10-3)9(5)2/h4H2,1-3H3 |
| InChIKey | PJLBVOXCHZBIEI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |