C22H25N2O4SY- — CID 58260095
trans-(1R,4R)-2-(4-tert-butyl-2-nitrophenyl)-4-isocyano-3-(2H-thiophen-2-id-5-ylmethoxymethyl)cyclopentan-1-ol;yttrium (PubChem CID 58260095) has the molecular formula C22H25N2O4SY- and a molecular weight of 502.43 g/mol. Its IUPAC name is trans-(1R,4R)-2-(4-tert-butyl-2-nitrophenyl)-4-isocyano-3-(2H-thiophen-2-id-5-ylmethoxymethyl)cyclopentan-1-ol;yttrium.
| Compound Name | trans-(1R,4R)-2-(4-tert-butyl-2-nitrophenyl)-4-isocyano-3-(2H-thiophen-2-id-5-ylmethoxymethyl)cyclopentan-1-ol;yttrium |
|---|---|
| PubChem CID | 58260095 |
| Molecular Formula | C22H25N2O4SY- |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | trans-(1R,4R)-2-(4-tert-butyl-2-nitrophenyl)-4-isocyano-3-(2H-thiophen-2-id-5-ylmethoxymethyl)cyclopentan-1-ol;yttrium |
| SMILES | [C-]#[N+][C@@H]1C[C@@H](O)C(c2ccc(C(C)(C)C)cc2[N+](=O)[O-])C1COCc1cc[c-]s1.[Y] |
| InChI | InChI=1S/C22H25N2O4S.Y/c1-22(2,3)14-7-8-16(19(10-14)24(26)27)21-17(18(23-4)11-20(21)25)13-28-12-15-6-5-9-29-15;/h5-8,10,17-18,20-21,25H,11-13H2,1-3H3;/q-1;/t17?,18-,20-,21?;/m1./s1 |
| InChIKey | KHHKKLBEMLTKDO-ONFYMRGYSA-N |
| XLogP | 4.72 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|