C15H24F4O4S — CID 58260920
(5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) 4-methylcyclohexane-1-carboxylate (PubChem CID 58260920) has the molecular formula C15H24F4O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) 4-methylcyclohexane-1-carboxylate.
| Compound Name | (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58260920 |
| Molecular Formula | C15H24F4O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)OCCCCC(F)(F)C(F)(F)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H24F4O4S/c1-11-5-7-12(8-6-11)13(20)23-10-4-3-9-14(16,17)15(18,19)24(2,21)22/h11-12H,3-10H2,1-2H3 |
| InChIKey | RVHJMYOIMSCXHT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|