C12H14F4O5S — CID 58260943
(5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) furan-2-carboxylate (PubChem CID 58260943) has the molecular formula C12H14F4O5S and a molecular weight of 346.30 g/mol. Its IUPAC name is (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) furan-2-carboxylate.
| Compound Name | (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) furan-2-carboxylate |
|---|---|
| PubChem CID | 58260943 |
| Molecular Formula | C12H14F4O5S |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) furan-2-carboxylate |
| SMILES | CS(=O)(=O)C(F)(F)C(F)(F)CCCCOC(=O)c1ccco1 |
| InChI | InChI=1S/C12H14F4O5S/c1-22(18,19)12(15,16)11(13,14)6-2-3-7-21-10(17)9-5-4-8-20-9/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | HUEZCSGYSAKJGC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|