C13H20F4O4S — CID 58260956
(5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) cyclopentanecarboxylate (PubChem CID 58260956) has the molecular formula C13H20F4O4S and a molecular weight of 348.36 g/mol. Its IUPAC name is (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) cyclopentanecarboxylate.
| Compound Name | (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) cyclopentanecarboxylate |
|---|---|
| PubChem CID | 58260956 |
| Molecular Formula | C13H20F4O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (5,5,6,6-tetrafluoro-6-methylsulfonylhexyl) cyclopentanecarboxylate |
| SMILES | CS(=O)(=O)C(F)(F)C(F)(F)CCCCOC(=O)C1CCCC1 |
| InChI | InChI=1S/C13H20F4O4S/c1-22(19,20)13(16,17)12(14,15)8-4-5-9-21-11(18)10-6-2-3-7-10/h10H,2-9H2,1H3 |
| InChIKey | FDEHQAKWNQYIQU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|