C12H14O2 — CID 582612
1,2,3,4-tetrahydronaphthalen-1-yl acetate (PubChem CID 582612) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl acetate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl acetate |
|---|---|
| PubChem CID | 582612 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl acetate |
| SMILES | CC(=O)OC1CCCc2ccccc21 |
| InChI | InChI=1S/C12H14O2/c1-9(13)14-12-8-4-6-10-5-2-3-7-11(10)12/h2-3,5,7,12H,4,6,8H2,1H3 |
| InChIKey | XAEPSGWPSVIKND-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |