C44H54N4 — CID 58261326
2,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]phenyl]benzimidazole (PubChem CID 58261326) has the molecular formula C44H54N4 and a molecular weight of 638.94 g/mol. Its IUPAC name is 2,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]phenyl]benzimidazole.
| Compound Name | 2,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 58261326 |
| Molecular Formula | C44H54N4 |
| Molecular Weight | 638.94 g/mol |
| Exact Mass | 638.43 |
| IUPAC Name | 2,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]phenyl]benzimidazole |
| SMILES | Cc1c(C)c(-n2nc(C)c3c(C)c(C)c(C)c(C)c32)c(C)c(C)c1-c1c(C)c(C)c(-n2c(C)nc3c(C)c(C)c(C)c(C)c32)c(C)c1C |
| InChI | InChI=1S/C44H54N4/c1-19-21(3)29(11)43-39(23(19)5)35(17)46-48(43)42-33(15)26(8)38(27(9)34(42)16)37-24(6)31(13)41(32(14)25(37)7)47-36(18)45-40-28(10)20(2)22(4)30(12)44(40)47/h1-18H3 |
| InChIKey | WTWNIXNHROLOES-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.94 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |