About tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol
tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol (PubChem CID 582616) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol.
Molecular Properties
| Compound Name | tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol |
| PubChem CID | 582616 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol |
| SMILES | OC1CC2CCC1c1ccccc12 |
| InChI | InChI=1S/C12H14O/c13-12-7-8-5-6-11(12)10-4-2-1-3-9(8)10/h1-4,8,11-13H,5-7H2 |
| InChIKey | ILPNNYVOVSPQCS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol?
The IUPAC name of tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol (CID 582616) is tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol.
What is the SMILES notation for tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol?
The canonical SMILES for tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol is OC1CC2CCC1c1ccccc12.
What is the InChIKey of tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol?
The InChIKey is ILPNNYVOVSPQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O/c13-12-7-8-5-6-11(12)10-4-2-1-3-9(8)10/h1-4,8,11-13H,5-7H2.
What are the key properties of tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol?
tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol has a molecular weight of 174.24 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.2.2.02,7]dodeca-2,4,6-trien-9-ol is sourced from PubChem (CID 582616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).