C40H33F5N4 — CID 58261670
2,4-bis(4-tert-butylphenyl)-6-[6-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-3-pyridinyl]-1,3,5-triazine (PubChem CID 58261670) has the molecular formula C40H33F5N4 and a molecular weight of 664.72 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[6-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[6-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58261670 |
| Molecular Formula | C40H33F5N4 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[6-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(-c4ccc(-c5c(F)c(F)c(F)c(F)c5F)cc4)nc3)n2)cc1 |
| InChI | InChI=1S/C40H33F5N4/c1-39(2,3)27-16-11-24(12-17-27)36-47-37(25-13-18-28(19-14-25)40(4,5)6)49-38(48-36)26-15-20-29(46-21-26)22-7-9-23(10-8-22)30-31(41)33(43)35(45)34(44)32(30)42/h7-21H,1-6H3 |
| InChIKey | RDAXMQAARMYDHA-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|