C74H69IrN8- — CID 58261707
2,4-bis[2-[3,5-bis(4-tert-butylphenyl)phenyl]pyrimidin-5-yl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium (PubChem CID 58261707) has the molecular formula C74H69IrN8- and a molecular weight of 1262.64 g/mol. Its IUPAC name is 2,4-bis[2-[3,5-bis(4-tert-butylphenyl)phenyl]pyrimidin-5-yl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium.
| Compound Name | 2,4-bis[2-[3,5-bis(4-tert-butylphenyl)phenyl]pyrimidin-5-yl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium |
|---|---|
| PubChem CID | 58261707 |
| Molecular Formula | C74H69IrN8- |
| Molecular Weight | 1262.64 g/mol |
| Exact Mass | 1262.53 |
| IUPAC Name | 2,4-bis[2-[3,5-bis(4-tert-butylphenyl)phenyl]pyrimidin-5-yl]-6-(6-phenyl-3-pyridinyl)-1,3,5-triazine;iridium |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3ncc(-c4nc(-c5ccc(-c6[c-]cccc6)nc5)nc(-c5cnc(-c6cc(-c7ccc(C(C)(C)C)cc7)cc(-c7ccc(C(C)(C)C)cc7)c6)nc5)n4)cn3)c2)cc1.[Ir] |
| InChI | InChI=1S/C74H69N8.Ir/c1-71(2,3)61-27-18-47(19-28-61)53-36-54(48-20-29-62(30-21-48)72(4,5)6)39-57(38-53)66-76-43-59(44-77-66)69-80-68(52-26-35-65(75-42-52)51-16-14-13-15-17-51)81-70(82-69)60-45-78-67(79-46-60)58-40-55(49-22-31-63(32-23-49)73(7,8)9)37-56(41-58)50-24-33-64(34-25-50)74(10,11)12;/h13-16,18-46H,1-12H3;/q-1; |
| InChIKey | OUWFVJVMHSVOBO-UHFFFAOYSA-N |
| XLogP | 18.50 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1262.64 |
| LogP ≤ 5 | 18.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|