C68H78N2 — CID 58261712
4,6-bis(9,9-dibutylfluoren-2-yl)-2-(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine (PubChem CID 58261712) has the molecular formula C68H78N2 and a molecular weight of 923.39 g/mol. Its IUPAC name is 4,6-bis(9,9-dibutylfluoren-2-yl)-2-(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine.
| Compound Name | 4,6-bis(9,9-dibutylfluoren-2-yl)-2-(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine |
|---|---|
| PubChem CID | 58261712 |
| Molecular Formula | C68H78N2 |
| Molecular Weight | 923.39 g/mol |
| Exact Mass | 922.62 |
| IUPAC Name | 4,6-bis(9,9-dibutylfluoren-2-yl)-2-(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine |
| SMILES | CCCCC1(CCCC)c2ccccc2-c2ccc(-c3cc(-c4ccc5c(c4)C(CCCC)(CCCC)c4ccccc4-5)nc(-c4ccc5c(c4)C(CCCC)(CCCC)c4cc(C)ccc4-5)n3)cc21 |
| InChI | InChI=1S/C68H78N2/c1-8-14-36-66(37-15-9-2)57-26-22-20-24-51(57)54-33-29-48(43-60(54)66)63-46-64(49-30-34-55-52-25-21-23-27-58(52)67(38-16-10-3,39-17-11-4)61(55)44-49)70-65(69-63)50-31-35-56-53-32-28-47(7)42-59(53)68(40-18-12-5,41-19-13-6)62(56)45-50/h20-35,42-46H,8-19,36-41H2,1-7H3 |
| InChIKey | XCWNCYLAKCAAFE-UHFFFAOYSA-N |
| XLogP | 19.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.39 |
| LogP ≤ 5 | 19.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |