C70H82N2 — CID 58261719
2,4,6-tris(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine (PubChem CID 58261719) has the molecular formula C70H82N2 and a molecular weight of 951.44 g/mol. Its IUPAC name is 2,4,6-tris(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine.
| Compound Name | 2,4,6-tris(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine |
|---|---|
| PubChem CID | 58261719 |
| Molecular Formula | C70H82N2 |
| Molecular Weight | 951.44 g/mol |
| Exact Mass | 950.65 |
| IUPAC Name | 2,4,6-tris(9,9-dibutyl-7-methylfluoren-2-yl)pyrimidine |
| SMILES | CCCCC1(CCCC)c2cc(C)ccc2-c2ccc(-c3cc(-c4ccc5c(c4)C(CCCC)(CCCC)c4cc(C)ccc4-5)nc(-c4ccc5c(c4)C(CCCC)(CCCC)c4cc(C)ccc4-5)n3)cc21 |
| InChI | InChI=1S/C70H82N2/c1-10-16-34-68(35-17-11-2)59-40-47(7)22-28-53(59)56-31-25-50(43-62(56)68)65-46-66(51-26-32-57-54-29-23-48(8)41-60(54)69(36-18-12-3,37-19-13-4)63(57)44-51)72-67(71-65)52-27-33-58-55-30-24-49(9)42-61(55)70(38-20-14-5,39-21-15-6)64(58)45-52/h22-33,40-46H,10-21,34-39H2,1-9H3 |
| InChIKey | GVIXBFLROWWDTH-UHFFFAOYSA-N |
| XLogP | 20.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.44 |
| LogP ≤ 5 | 20.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |