C12H6N2O2 — CID 58262188
5,8-dioxa-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene (PubChem CID 58262188) has the molecular formula C12H6N2O2 and a molecular weight of 210.19 g/mol. Its IUPAC name is 5,8-dioxa-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene.
| Compound Name | 5,8-dioxa-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene |
|---|---|
| PubChem CID | 58262188 |
| Molecular Formula | C12H6N2O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 5,8-dioxa-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene |
| SMILES | c1ccc2c(c1)c1ncoc1c1ocnc21 |
| InChI | InChI=1S/C12H6N2O2/c1-2-4-8-7(3-1)9-11(15-5-13-9)12-10(8)14-6-16-12/h1-6H |
| InChIKey | GHIFFABDZGRUMN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |