C80H92N4O8Pt — CID 58262484
butyl 3-butyl-5-[10,15,20-tris(3-butoxycarbonyl-5-butylphenyl)porphyrin-22,24-diid-5-yl]benzoate;platinum(2+) (PubChem CID 58262484) has the molecular formula C80H92N4O8Pt and a molecular weight of 1432.71 g/mol. Its IUPAC name is butyl 3-butyl-5-[10,15,20-tris(3-butoxycarbonyl-5-butylphenyl)porphyrin-22,24-diid-5-yl]benzoate;platinum(2+).
| Compound Name | butyl 3-butyl-5-[10,15,20-tris(3-butoxycarbonyl-5-butylphenyl)porphyrin-22,24-diid-5-yl]benzoate;platinum(2+) |
|---|---|
| PubChem CID | 58262484 |
| Molecular Formula | C80H92N4O8Pt |
| Molecular Weight | 1432.71 g/mol |
| Exact Mass | 1431.66 |
| IUPAC Name | butyl 3-butyl-5-[10,15,20-tris(3-butoxycarbonyl-5-butylphenyl)porphyrin-22,24-diid-5-yl]benzoate;platinum(2+) |
| SMILES | CCCCOC(=O)c1cc(CCCC)cc(-c2c3nc(c(-c4cc(CCCC)cc(C(=O)OCCCC)c4)c4ccc([n-]4)c(-c4cc(CCCC)cc(C(=O)OCCCC)c4)c4nc(c(-c5cc(CCCC)cc(C(=O)OCCCC)c5)c5ccc2[n-]5)C=C4)C=C3)c1.[Pt+2] |
| InChI | InChI=1S/C80H92N4O8.Pt/c1-9-17-25-53-41-57(49-61(45-53)77(85)89-37-21-13-5)73-65-29-31-67(81-65)74(58-42-54(26-18-10-2)46-62(50-58)78(86)90-38-22-14-6)69-33-35-71(83-69)76(60-44-56(28-20-12-4)48-64(52-60)80(88)92-40-24-16-8)72-36-34-70(84-72)75(68-32-30-66(73)82-68)59-43-55(27-19-11-3)47-63(51-59)79(87)91-39-23-15-7;/h29-36,41-52H,9-28,37-40H2,1-8H3;/q-2;+2/b73-65-,73-66-,74-67-,74-69-,75-68-,75-70-,76-71-,76-72-; |
| InChIKey | GAIGDYKSKWRFLF-LOJAHXFYSA-N |
| XLogP | 19.78 |
| TPSA | 159.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1432.71 |
| LogP ≤ 5 | 19.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|