C32H49NO6 — CID 58262657
3-methylbutan-2-yl (3S)-3-cyclohexyl-4-[(2S)-6,6-dimethyl-2-[3-(2-oxopropanoyl)hept-6-enoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobutanoate (PubChem CID 58262657) has the molecular formula C32H49NO6 and a molecular weight of 543.75 g/mol. Its IUPAC name is 3-methylbutan-2-yl (3S)-3-cyclohexyl-4-[(2S)-6,6-dimethyl-2-[3-(2-oxopropanoyl)hept-6-enoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobutanoate.
| Compound Name | 3-methylbutan-2-yl (3S)-3-cyclohexyl-4-[(2S)-6,6-dimethyl-2-[3-(2-oxopropanoyl)hept-6-enoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 58262657 |
| Molecular Formula | C32H49NO6 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | 3-methylbutan-2-yl (3S)-3-cyclohexyl-4-[(2S)-6,6-dimethyl-2-[3-(2-oxopropanoyl)hept-6-enoyl]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobutanoate |
| SMILES | C=CCCC(CC(=O)[C@@H]1C2C(CN1C(=O)[C@@H](CC(=O)OC(C)C(C)C)C1CCCCC1)C2(C)C)C(=O)C(C)=O |
| InChI | InChI=1S/C32H49NO6/c1-8-9-13-23(30(37)20(4)34)16-26(35)29-28-25(32(28,6)7)18-33(29)31(38)24(22-14-11-10-12-15-22)17-27(36)39-21(5)19(2)3/h8,19,21-25,28-29H,1,9-18H2,2-7H3/t21?,23?,24-,25?,28?,29+/m0/s1 |
| InChIKey | XABPOIQAXUJZLD-ROAHHWNBSA-N |
| XLogP | 5.34 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|