C31H46F3N3O5 — CID 58262670
1-tert-butyl-3-[(1S)-1-cyclohexyl-2-[(1R,2S,5S)-2-[4,5-dioxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]urea (PubChem CID 58262670) has the molecular formula C31H46F3N3O5 and a molecular weight of 597.72 g/mol. Its IUPAC name is 1-tert-butyl-3-[(1S)-1-cyclohexyl-2-[(1R,2S,5S)-2-[4,5-dioxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]urea.
| Compound Name | 1-tert-butyl-3-[(1S)-1-cyclohexyl-2-[(1R,2S,5S)-2-[4,5-dioxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 58262670 |
| Molecular Formula | C31H46F3N3O5 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | 1-tert-butyl-3-[(1S)-1-cyclohexyl-2-[(1R,2S,5S)-2-[4,5-dioxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]urea |
| SMILES | C=CCCC(=O)C(=O)C(CC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)NC(C)(C)C)C1CCCCC1)C2(C)C)CC(F)(F)F |
| InChI | InChI=1S/C31H46F3N3O5/c1-7-8-14-21(38)26(40)19(16-31(32,33)34)15-22(39)25-23-20(30(23,5)6)17-37(25)27(41)24(18-12-10-9-11-13-18)35-28(42)36-29(2,3)4/h7,18-20,23-25H,1,8-17H2,2-6H3,(H2,35,36,42)/t19?,20-,23-,24-,25+/m0/s1 |
| InChIKey | JMVPAOWECJQVLP-NCNTWFCFSA-N |
| XLogP | 5.15 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|