C33H52N4O7 — CID 58262739
tert-butyl N-[(1S)-2-[(4S)-4-[[1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58262739) has the molecular formula C33H52N4O7 and a molecular weight of 616.80 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(4S)-4-[[1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(4S)-4-[[1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58262739 |
| Molecular Formula | C33H52N4O7 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(4S)-4-[[1-(but-3-enylamino)-1,2-dioxohept-6-en-3-yl]carbamoyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-5-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | C=CCCNC(=O)C(=O)C(CCC=C)NC(=O)[C@@H]1C2CC(C)(C)OC2CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C33H52N4O7/c1-8-10-17-23(27(38)29(40)34-18-11-9-2)35-28(39)26-22-19-33(6,7)43-24(22)20-37(26)30(41)25(21-15-13-12-14-16-21)36-31(42)44-32(3,4)5/h8-9,21-26H,1-2,10-20H2,3-7H3,(H,34,40)(H,35,39)(H,36,42)/t22?,23?,24?,25-,26-/m0/s1 |
| InChIKey | JIWXDWNTIMSLFW-UZUOBHKXSA-N |
| XLogP | 3.57 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|