C28H45N3O6 — CID 58262772
tert-butyl 3-[2-[[1-cyclobutyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-4,4-dimethylpentanoate (PubChem CID 58262772) has the molecular formula C28H45N3O6 and a molecular weight of 519.68 g/mol. Its IUPAC name is tert-butyl 3-[2-[[1-cyclobutyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-4,4-dimethylpentanoate.
| Compound Name | tert-butyl 3-[2-[[1-cyclobutyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 58262772 |
| Molecular Formula | C28H45N3O6 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | tert-butyl 3-[2-[[1-cyclobutyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-4,4-dimethylpentanoate |
| SMILES | C=CCNC(=O)C(=O)C(CC1CCC1)NC(=O)C1CCCN1C(=O)C(CC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H45N3O6/c1-8-14-29-25(35)23(33)20(16-18-11-9-12-18)30-24(34)21-13-10-15-31(21)26(36)19(27(2,3)4)17-22(32)37-28(5,6)7/h8,18-21H,1,9-17H2,2-7H3,(H,29,35)(H,30,34) |
| InChIKey | UQLZQTKSWQBYAM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|