C30H46Cl2N2O5 — CID 58262859
3-(cyclobutylmethyl)-5-[(1S,2S,5R)-6,6-dichloro-3-[(2S)-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-hydroxy-5-oxopentanamide (PubChem CID 58262859) has the molecular formula C30H46Cl2N2O5 and a molecular weight of 585.61 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-5-[(1S,2S,5R)-6,6-dichloro-3-[(2S)-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-hydroxy-5-oxopentanamide.
| Compound Name | 3-(cyclobutylmethyl)-5-[(1S,2S,5R)-6,6-dichloro-3-[(2S)-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-hydroxy-5-oxopentanamide |
|---|---|
| PubChem CID | 58262859 |
| Molecular Formula | C30H46Cl2N2O5 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 3-(cyclobutylmethyl)-5-[(1S,2S,5R)-6,6-dichloro-3-[(2S)-2-cyclohexyl-6,6-dimethyl-4-oxoheptanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2-hydroxy-5-oxopentanamide |
| SMILES | CC(C)(C)CC(=O)C[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)CC(CC1CCC1)C(O)C(N)=O)C2(Cl)Cl)C1CCCCC1 |
| InChI | InChI=1S/C30H46Cl2N2O5/c1-29(2,3)15-20(35)14-21(18-10-5-4-6-11-18)28(39)34-16-22-24(30(22,31)32)25(34)23(36)13-19(26(37)27(33)38)12-17-8-7-9-17/h17-19,21-22,24-26,37H,4-16H2,1-3H3,(H2,33,38)/t19?,21-,22-,24-,25+,26?/m0/s1 |
| InChIKey | BDJOODMZEOTOLW-CYTSCEOQSA-N |
| XLogP | 4.82 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|