C28H43F2NO6 — CID 58262883
tert-butyl (3S)-3-[(2S)-2-(4,5-dioxo-3-propylnon-8-enoyl)-4,4-difluoropyrrolidine-1-carbonyl]-4,4-dimethylpentanoate (PubChem CID 58262883) has the molecular formula C28H43F2NO6 and a molecular weight of 527.65 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2S)-2-(4,5-dioxo-3-propylnon-8-enoyl)-4,4-difluoropyrrolidine-1-carbonyl]-4,4-dimethylpentanoate.
| Compound Name | tert-butyl (3S)-3-[(2S)-2-(4,5-dioxo-3-propylnon-8-enoyl)-4,4-difluoropyrrolidine-1-carbonyl]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 58262883 |
| Molecular Formula | C28H43F2NO6 |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | tert-butyl (3S)-3-[(2S)-2-(4,5-dioxo-3-propylnon-8-enoyl)-4,4-difluoropyrrolidine-1-carbonyl]-4,4-dimethylpentanoate |
| SMILES | C=CCCC(=O)C(=O)C(CCC)CC(=O)[C@@H]1CC(F)(F)CN1C(=O)[C@@H](CC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H43F2NO6/c1-9-11-13-21(32)24(35)18(12-10-2)14-22(33)20-16-28(29,30)17-31(20)25(36)19(26(3,4)5)15-23(34)37-27(6,7)8/h9,18-20H,1,10-17H2,2-8H3/t18?,19-,20+/m1/s1 |
| InChIKey | NHHFPXSLHDPTQL-HUSUDBNBSA-N |
| XLogP | 5.10 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|