C29H42F3N3O6 — CID 58262984
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58262984) has the molecular formula C29H42F3N3O6 and a molecular weight of 585.66 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58262984 |
| Molecular Formula | C29H42F3N3O6 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CC1(C)[C@@H]2[C@@H](C(=O)CC(CC3CC3)C(=O)C(N)=O)N(C(=O)[C@@H](NC(=O)OC(C)(C)C(F)(F)F)C3CCCCC3)C[C@@H]21 |
| InChI | InChI=1S/C29H42F3N3O6/c1-27(2)18-14-35(22(20(18)27)19(36)13-17(12-15-10-11-15)23(37)24(33)38)25(39)21(16-8-6-5-7-9-16)34-26(40)41-28(3,4)29(30,31)32/h15-18,20-22H,5-14H2,1-4H3,(H2,33,38)(H,34,40)/t17?,18-,20-,21-,22+/m0/s1 |
| InChIKey | RLERSFIMKXEKCW-KGZGCZEESA-N |
| XLogP | 3.92 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|