About 2-methylindolizine
2-methylindolizine (PubChem CID 582630) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 2-methylindolizine.
Molecular Properties
| Compound Name | 2-methylindolizine |
| PubChem CID | 582630 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 2-methylindolizine |
| SMILES | Cc1cc2ccccn2c1 |
| InChI | InChI=1S/C9H9N/c1-8-6-9-4-2-3-5-10(9)7-8/h2-7H,1H3 |
| InChIKey | HRUAZBSVPMQJJL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylindolizine?
The IUPAC name of 2-methylindolizine (CID 582630) is 2-methylindolizine.
What is the SMILES notation for 2-methylindolizine?
The canonical SMILES for 2-methylindolizine is Cc1cc2ccccn2c1.
What is the InChIKey of 2-methylindolizine?
The InChIKey is HRUAZBSVPMQJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-8-6-9-4-2-3-5-10(9)7-8/h2-7H,1H3.
What are the key properties of 2-methylindolizine?
2-methylindolizine has a molecular weight of 131.18 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylindolizine is sourced from PubChem (CID 582630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).