C27H40F3N3O6 — CID 58263014
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[(1R)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 58263014) has the molecular formula C27H40F3N3O6 and a molecular weight of 559.63 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[(1R)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[(1R)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58263014 |
| Molecular Formula | C27H40F3N3O6 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[1-[(1R)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)C(NC(=O)OC(C)(C)C(F)(F)F)C(=O)N1CC2[C@@H](C1C(=O)CC(CC1CC1)C(=O)C(N)=O)C2(C)C |
| InChI | InChI=1S/C27H40F3N3O6/c1-24(2,3)20(32-23(38)39-26(6,7)27(28,29)30)22(37)33-12-15-17(25(15,4)5)18(33)16(34)11-14(10-13-8-9-13)19(35)21(31)36/h13-15,17-18,20H,8-12H2,1-7H3,(H2,31,36)(H,32,38)/t14?,15?,17-,18?,20?/m0/s1 |
| InChIKey | RIHZEYCIOUHKJT-KXUGPNDVSA-N |
| XLogP | 3.38 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|