C29H43F2N3O6 — CID 58263309
tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate (PubChem CID 58263309) has the molecular formula C29H43F2N3O6 and a molecular weight of 567.67 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58263309 |
| Molecular Formula | C29H43F2N3O6 |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-[5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)CC(CC1CC1)C(=O)C(N)=O)C2(C)C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C29H43F2N3O6/c1-27(2,3)40-26(39)33-21(16-8-10-29(30,31)11-9-16)25(38)34-14-18-20(28(18,4)5)22(34)19(35)13-17(12-15-6-7-15)23(36)24(32)37/h15-18,20-22H,6-14H2,1-5H3,(H2,32,37)(H,33,39)/t17?,18-,20-,21-,22+/m0/s1 |
| InChIKey | YSKOTMOWCCDFEK-KGZGCZEESA-N |
| XLogP | 3.62 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|