C26H46N4O4 — CID 58263321
1-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 58263321) has the molecular formula C26H46N4O4 and a molecular weight of 478.68 g/mol. Its IUPAC name is 1-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58263321 |
| Molecular Formula | C26H46N4O4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | 1-[2-(3,3-dimethylbutylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1CCCN1C(=O)C(NCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H46N4O4/c1-9-12-18(20(31)23(33)28-15-10-2)29-22(32)19-13-11-17-30(19)24(34)21(26(6,7)8)27-16-14-25(3,4)5/h10,18-19,21,27H,2,9,11-17H2,1,3-8H3,(H,28,33)(H,29,32) |
| InChIKey | COILFHURQIKDMH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|