About 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol
1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol (PubChem CID 58263788) has the molecular formula C12H26OS
and a molecular weight of 218.41 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol |
| PubChem CID | 58263788 |
| Molecular Formula | C12H26OS |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CSCC(O)CC(C)(C)C |
| InChI | InChI=1S/C12H26OS/c1-11(2,3)7-10(13)8-14-9-12(4,5)6/h10,13H,7-9H2,1-6H3 |
| InChIKey | MSVBOUROMOEOPD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol?
The IUPAC name of 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol (CID 58263788) is 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol?
The canonical SMILES for 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol is CC(C)(C)CSCC(O)CC(C)(C)C.
What is the InChIKey of 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol?
The InChIKey is MSVBOUROMOEOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26OS/c1-11(2,3)7-10(13)8-14-9-12(4,5)6/h10,13H,7-9H2,1-6H3.
What are the key properties of 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol?
1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol has a molecular weight of 218.41 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropylsulfanyl)-4,4-dimethylpentan-2-ol is sourced from PubChem (CID 58263788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).