C11H14O — CID 582638
1-methoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 582638) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 1-methoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-methoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 582638 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-methoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H14O/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7,11H,4,6,8H2,1H3 |
| InChIKey | IBRIMMDNSPFZMB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |