About 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole
5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole (PubChem CID 58263857) has the molecular formula C14H25NOS
and a molecular weight of 255.43 g/mol. Its IUPAC name is 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole |
| PubChem CID | 58263857 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole |
| SMILES | CC(C)(C)CSCCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C14H25NOS/c1-13(2,3)10-17-8-7-12-15-9-11(16-12)14(4,5)6/h9H,7-8,10H2,1-6H3 |
| InChIKey | CZMUKTARPJSZGN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole?
The IUPAC name of 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole (CID 58263857) is 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole.
What is the SMILES notation for 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole?
The canonical SMILES for 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole is CC(C)(C)CSCCc1ncc(C(C)(C)C)o1.
What is the InChIKey of 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole?
The InChIKey is CZMUKTARPJSZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NOS/c1-13(2,3)10-17-8-7-12-15-9-11(16-12)14(4,5)6/h9H,7-8,10H2,1-6H3.
What are the key properties of 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole?
5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole has a molecular weight of 255.43 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-1,3-oxazole is sourced from PubChem (CID 58263857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).