C15H27NS — CID 58263926
5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-3H-pyrrole (PubChem CID 58263926) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-3H-pyrrole.
| Compound Name | 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-3H-pyrrole |
|---|---|
| PubChem CID | 58263926 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 5-tert-butyl-2-[2-(2,2-dimethylpropylsulfanyl)ethyl]-3H-pyrrole |
| SMILES | CC(C)(C)CSCCC1=NC(C(C)(C)C)=CC1 |
| InChI | InChI=1S/C15H27NS/c1-14(2,3)11-17-10-9-12-7-8-13(16-12)15(4,5)6/h8H,7,9-11H2,1-6H3 |
| InChIKey | REUPFFZNBCLUAK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|