C31H25F3N2O4 — CID 58263984
N-methyl-4-[5-[2-[4-(3-oxopent-4-enyl)-3-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide (PubChem CID 58263984) has the molecular formula C31H25F3N2O4 and a molecular weight of 546.55 g/mol. Its IUPAC name is N-methyl-4-[5-[2-[4-(3-oxopent-4-enyl)-3-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide.
| Compound Name | N-methyl-4-[5-[2-[4-(3-oxopent-4-enyl)-3-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 58263984 |
| Molecular Formula | C31H25F3N2O4 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N-methyl-4-[5-[2-[4-(3-oxopent-4-enyl)-3-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide |
| SMILES | C=CC(=O)CCc1ccc(CC(=O)c2cccc3c(Oc4ccnc(C(=O)NC)c4)cccc23)cc1C(F)(F)F |
| InChI | InChI=1S/C31H25F3N2O4/c1-3-21(37)13-12-20-11-10-19(16-26(20)31(32,33)34)17-28(38)24-7-4-8-25-23(24)6-5-9-29(25)40-22-14-15-36-27(18-22)30(39)35-2/h3-11,14-16,18H,1,12-13,17H2,2H3,(H,35,39) |
| InChIKey | CDUWYGIPIYPOEX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|