C33H25F3N2O4 — CID 58264024
N-[5-[2-[5-(6-methoxy-7-methylquinolin-4-yl)oxynaphthalen-1-yl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 58264024) has the molecular formula C33H25F3N2O4 and a molecular weight of 570.57 g/mol. Its IUPAC name is N-[5-[2-[5-(6-methoxy-7-methylquinolin-4-yl)oxynaphthalen-1-yl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[5-[2-[5-(6-methoxy-7-methylquinolin-4-yl)oxynaphthalen-1-yl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58264024 |
| Molecular Formula | C33H25F3N2O4 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | N-[5-[2-[5-(6-methoxy-7-methylquinolin-4-yl)oxynaphthalen-1-yl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(CC(=O)c2cccc3c(Oc4ccnc5cc(C)c(OC)cc45)cccc23)ccc1C(F)(F)F |
| InChI | InChI=1S/C33H25F3N2O4/c1-4-32(40)38-27-16-20(11-12-25(27)33(34,35)36)17-28(39)22-8-5-9-23-21(22)7-6-10-29(23)42-30-13-14-37-26-15-19(2)31(41-3)18-24(26)30/h4-16,18H,1,17H2,2-3H3,(H,38,40) |
| InChIKey | NVTUNFWMPNYCFX-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|