About 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole
5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole (PubChem CID 58264046) has the molecular formula C13H24N2S
and a molecular weight of 240.42 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole.
Molecular Properties
| Compound Name | 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole |
| PubChem CID | 58264046 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole |
| SMILES | Cn1nc(SCC(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C13H24N2S/c1-12(2,3)9-16-11-8-10(13(4,5)6)15(7)14-11/h8H,9H2,1-7H3 |
| InChIKey | NJRHWTLTWXYLHL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole?
The IUPAC name of 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole (CID 58264046) is 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole.
What is the SMILES notation for 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole?
The canonical SMILES for 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole is Cn1nc(SCC(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole?
The InChIKey is NJRHWTLTWXYLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2S/c1-12(2,3)9-16-11-8-10(13(4,5)6)15(7)14-11/h8H,9H2,1-7H3.
What are the key properties of 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole?
5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole has a molecular weight of 240.42 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-(2,2-dimethylpropylsulfanyl)-1-methylpyrazole is sourced from PubChem (CID 58264046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).