C29H22F3N3O4 — CID 58264107
N-methyl-4-[5-[2-[3-(prop-2-enoylamino)-4-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide (PubChem CID 58264107) has the molecular formula C29H22F3N3O4 and a molecular weight of 533.51 g/mol. Its IUPAC name is N-methyl-4-[5-[2-[3-(prop-2-enoylamino)-4-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide.
| Compound Name | N-methyl-4-[5-[2-[3-(prop-2-enoylamino)-4-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 58264107 |
| Molecular Formula | C29H22F3N3O4 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | N-methyl-4-[5-[2-[3-(prop-2-enoylamino)-4-(trifluoromethyl)phenyl]acetyl]naphthalen-1-yl]oxypyridine-2-carboxamide |
| SMILES | C=CC(=O)Nc1cc(CC(=O)c2cccc3c(Oc4ccnc(C(=O)NC)c4)cccc23)ccc1C(F)(F)F |
| InChI | InChI=1S/C29H22F3N3O4/c1-3-27(37)35-23-14-17(10-11-22(23)29(30,31)32)15-25(36)20-7-4-8-21-19(20)6-5-9-26(21)39-18-12-13-34-24(16-18)28(38)33-2/h3-14,16H,1,15H2,2H3,(H,33,38)(H,35,37) |
| InChIKey | JNIOZUGCXKNHCH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|