About N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide
N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide (PubChem CID 58264400) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide |
| PubChem CID | 58264400 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide |
| SMILES | [N-]=[N+]=NCCNC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C8H10N4O/c9-12-11-6-5-10-8(13)7-3-1-2-4-7/h1-3H,4-6H2,(H,10,13) |
| InChIKey | XOGCALBUVSPAFF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide?
The IUPAC name of N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide (CID 58264400) is N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide.
What is the SMILES notation for N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide?
The canonical SMILES for N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide is [N-]=[N+]=NCCNC(=O)C1=CC=CC1.
What is the InChIKey of N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide?
The InChIKey is XOGCALBUVSPAFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-12-11-6-5-10-8(13)7-3-1-2-4-7/h1-3H,4-6H2,(H,10,13).
What are the key properties of N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide?
N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide has a molecular weight of 178.19 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-azidoethyl)cyclopenta-1,3-diene-1-carboxamide is sourced from PubChem (CID 58264400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).