About N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide
N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide (PubChem CID 58264639) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
| PubChem CID | 58264639 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC2CC1C1OC21 |
| InChI | InChI=1S/C12H19NO2/c1-12(2,3)13-11(14)8-5-6-4-7(8)10-9(6)15-10/h6-10H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | NEQQZHSHLRPULG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide?
The IUPAC name of N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide (CID 58264639) is N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide.
What is the SMILES notation for N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide?
The canonical SMILES for N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide is CC(C)(C)NC(=O)C1CC2CC1C1OC21.
What is the InChIKey of N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide?
The InChIKey is NEQQZHSHLRPULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-12(2,3)13-11(14)8-5-6-4-7(8)10-9(6)15-10/h6-10H,4-5H2,1-3H3,(H,13,14).
What are the key properties of N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide?
N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide has a molecular weight of 209.29 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxamide is sourced from PubChem (CID 58264639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).