C23H26F2O12S — CID 58264646
[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58264646) has the molecular formula C23H26F2O12S and a molecular weight of 564.51 g/mol. Its IUPAC name is [2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | [2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58264646 |
| Molecular Formula | C23H26F2O12S |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | [2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethyl] 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(COC(=O)C1C2CC3C(OC(=O)C31)C2OC(=O)C(F)(F)SOOO)OC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C23H26F2O12S/c24-23(25,38-37-36-31)20(29)34-17-11-2-12-15(19(28)33-16(12)17)14(11)18(27)32-7-13(26)35-22-5-9-1-10(6-22)4-21(30,3-9)8-22/h9-12,14-17,30-31H,1-8H2 |
| InChIKey | GYMIQEDDPPSZCB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|