C27H34F2O9 — CID 58264658
2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]ethyl 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58264658) has the molecular formula C27H34F2O9 and a molecular weight of 540.56 g/mol. Its IUPAC name is 2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]ethyl 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]ethyl 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58264658 |
| Molecular Formula | C27H34F2O9 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]ethyl 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC(F)(F)C(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OCCOCC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H34F2O9/c1-26(14-6-12-5-13(8-14)9-15(26)7-12)38-18(30)11-34-3-4-35-23(31)19-16-10-17-20(19)24(32)36-21(17)22(16)37-25(33)27(2,28)29/h12-17,19-22H,3-11H2,1-2H3 |
| InChIKey | IPUMXXQAJPDYIG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|