C22H26F2O7 — CID 58264668
(3-hydroxy-1-adamantyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58264668) has the molecular formula C22H26F2O7 and a molecular weight of 440.44 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (3-hydroxy-1-adamantyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58264668 |
| Molecular Formula | C22H26F2O7 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2-(2,2-difluoropropanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC(F)(F)C(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C22H26F2O7/c1-20(23,24)19(27)30-16-12-3-11-13(17(25)29-15(11)16)14(12)18(26)31-22-6-9-2-10(7-22)5-21(28,4-9)8-22/h9-16,28H,2-8H2,1H3 |
| InChIKey | TUCFKYKUIDBXNS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|