C25H32F2O9 — CID 58264704
2-[[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate (PubChem CID 58264704) has the molecular formula C25H32F2O9 and a molecular weight of 514.52 g/mol. Its IUPAC name is 2-[[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate.
| Compound Name | 2-[[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 58264704 |
| Molecular Formula | C25H32F2O9 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 2-[[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-1-adamantyl]oxy]ethyl 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OCCOC12CC3CC(O)(C1)CC(OCC(=O)OC1C4CC5C(=O)OC1C5C4)(C3)C2 |
| InChI | InChI=1S/C25H32F2O9/c1-22(26,27)21(30)32-2-3-33-24-7-13-6-23(31,10-24)11-25(8-13,12-24)34-9-17(28)35-18-14-4-15-16(5-14)20(29)36-19(15)18/h13-16,18-19,31H,2-12H2,1H3 |
| InChIKey | DWAXIIZGVOPBCN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|