About 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol
3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol (PubChem CID 58264934) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol.
Molecular Properties
| Compound Name | 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol |
| PubChem CID | 58264934 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol |
| SMILES | C=C(OC12CC3CC(CC(O)(C3)C1)C2)C(C)(C)CC |
| InChI | InChI=1S/C17H28O2/c1-5-15(3,4)12(2)19-17-9-13-6-14(10-17)8-16(18,7-13)11-17/h13-14,18H,2,5-11H2,1,3-4H3 |
| InChIKey | RZQQOUWQJXHBCG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol?
The IUPAC name of 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol (CID 58264934) is 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol.
What is the SMILES notation for 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol?
The canonical SMILES for 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol is C=C(OC12CC3CC(CC(O)(C3)C1)C2)C(C)(C)CC.
What is the InChIKey of 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol?
The InChIKey is RZQQOUWQJXHBCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-5-15(3,4)12(2)19-17-9-13-6-14(10-17)8-16(18,7-13)11-17/h13-14,18H,2,5-11H2,1,3-4H3.
What are the key properties of 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol?
3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol has a molecular weight of 264.41 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylpent-1-en-2-yloxy)adamantan-1-ol is sourced from PubChem (CID 58264934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).