C6H8N5O+ — CID 58264951
4-amino-8-methyl-3H-imidazo[1,2-a][1,3,5]triazin-5-ium-2-one (PubChem CID 58264951) has the molecular formula C6H8N5O+ and a molecular weight of 166.16 g/mol. Its IUPAC name is 4-amino-8-methyl-3H-imidazo[1,2-a][1,3,5]triazin-5-ium-2-one.
| Compound Name | 4-amino-8-methyl-3H-imidazo[1,2-a][1,3,5]triazin-5-ium-2-one |
|---|---|
| PubChem CID | 58264951 |
| Molecular Formula | C6H8N5O+ |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 4-amino-8-methyl-3H-imidazo[1,2-a][1,3,5]triazin-5-ium-2-one |
| SMILES | Cn1cc[n+]2c(N)[nH]c(=O)nc12 |
| InChI | InChI=1S/C6H7N5O/c1-10-2-3-11-4(7)8-5(12)9-6(10)11/h2-3H,1H3,(H2,7,8,12)/p+1 |
| InChIKey | OXMSVJNIWYBMKO-UHFFFAOYSA-O |
| XLogP | -1.57 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|