C27H39NO4 — CID 58264971
(3E,5E,7Z,13E,15E,17E)-20-[(E)-hex-2-enyl]-9,10,12-trihydroxy-7,15-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one (PubChem CID 58264971) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is (3E,5E,7Z,13E,15E,17E)-20-[(E)-hex-2-enyl]-9,10,12-trihydroxy-7,15-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one.
| Compound Name | (3E,5E,7Z,13E,15E,17E)-20-[(E)-hex-2-enyl]-9,10,12-trihydroxy-7,15-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 58264971 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | (3E,5E,7Z,13E,15E,17E)-20-[(E)-hex-2-enyl]-9,10,12-trihydroxy-7,15-dimethyl-1-azacycloicosa-3,5,7,13,15,17-hexaen-2-one |
| SMILES | CCC/C=C/CC1C/C=C/C=C(C)/C=C/C(O)CC(O)C(O)/C=C(C)\C=C\C=C\C(=O)N1 |
| InChI | InChI=1S/C27H39NO4/c1-4-5-6-7-14-23-15-10-8-12-21(2)17-18-24(29)20-26(31)25(30)19-22(3)13-9-11-16-27(32)28-23/h6-13,16-19,23-26,29-31H,4-5,14-15,20H2,1-3H3,(H,28,32)/b7-6+,10-8+,13-9+,16-11+,18-17+,21-12+,22-19- |
| InChIKey | RMIZTRGXRILREN-LFHZJQMWSA-N |
| XLogP | 4.21 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|