C26H31N2O9PS2 — CID 58266162
N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(4-methylsulfonylphenoxy)-5-[(3R)-oxolan-3-yl]oxybenzamide (PubChem CID 58266162) has the molecular formula C26H31N2O9PS2 and a molecular weight of 610.65 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(4-methylsulfonylphenoxy)-5-[(3R)-oxolan-3-yl]oxybenzamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(4-methylsulfonylphenoxy)-5-[(3R)-oxolan-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 58266162 |
| Molecular Formula | C26H31N2O9PS2 |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)-1,3-thiazol-2-yl]-3-(4-methylsulfonylphenoxy)-5-[(3R)-oxolan-3-yl]oxybenzamide |
| SMILES | CCOP(=O)(Cc1csc(NC(=O)c2cc(Oc3ccc(S(C)(=O)=O)cc3)cc(O[C@@H]3CCOC3)c2)n1)OCC |
| InChI | InChI=1S/C26H31N2O9PS2/c1-4-34-38(30,35-5-2)16-19-17-39-26(27-19)28-25(29)18-12-22(14-23(13-18)37-21-10-11-33-15-21)36-20-6-8-24(9-7-20)40(3,31)32/h6-9,12-14,17,21H,4-5,10-11,15-16H2,1-3H3,(H,27,28,29)/t21-/m1/s1 |
| InChIKey | OBYSKORHPUBUHA-OAQYLSRUSA-N |
| XLogP | 5.53 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|